loading...| Preferred Name | citric acid | |
| Synonyms |
H3cit 192.12350 C6H8O7 InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) 2-Hydroxytricarballylic acid KRKNYBCHXYNGOX-UHFFFAOYSA-N 3-Carboxy-3-hydroxypentane-1,5-dioic acid Citronensaeure 2-Hydroxy-1,2,3-propanetricarboxylic acid OC(=O)CC(O)(CC(O)=O)C(O)=O E330 citric acid CITRIC ACID 2-hydroxypropane-1,2,3-tricarboxylic acid Citric acid |
|
| Definitions |
A tricarboxylic acid that is propane-1,2,3-tricarboxylic acid bearing a hydroxy substituent at position 2. It is an important metabolite in the pathway of all aerobic organisms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30769 |
|
| database_cross_reference |
PMID:15934243 PMID:11762832 PMID:22373571 MetaCyc:CIT PMID:15311880 PMID:16232627 PMID:19288211 PDBeChem:CIT Wikipedia:Citric_Acid PMID:11782123 PMID:22509852 PMID:22192423 PMID:22264346 PMID:11857437 Beilstein:782061 PMID:18960216 Reaxys:782061 KEGG:C00158 PMID:18298573 KNApSAcK:C00007619 DrugBank:DB04272 PMID:17190852 PMID:22115968 Gmelin:4240 CAS:77-92-9 PMID:14537820 KEGG:D00037 PMID:17357118 HMDB:HMDB00094 PMID:17604395 |
|
| definition |
A tricarboxylic acid that is propane-1,2,3-tricarboxylic acid bearing a hydroxy substituent at position 2. It is an important metabolite in the pathway of all aerobic organisms. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_64049 http://purl.obolibrary.org/obo/CHEBI_33281 |
|
| has_alternative_id |
CHEBI:3727 CHEBI:41523 CHEBI:23322 |
|
| has_exact_synonym |
citric acid CITRIC ACID 2-hydroxypropane-1,2,3-tricarboxylic acid Citric acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
H3cit 192.12350 C6H8O7 InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) 2-Hydroxytricarballylic acid KRKNYBCHXYNGOX-UHFFFAOYSA-N 3-Carboxy-3-hydroxypentane-1,5-dioic acid Citronensaeure 2-Hydroxy-1,2,3-propanetricarboxylic acid OC(=O)CC(O)(CC(O)=O)C(O)=O E330 |
|
| id |
CHEBI:30769 |
|
| imported from | ||
| is conjugate acid of | ||
| label |
citric acid |
|
| notation |
CHEBI:30769 |
|
| prefLabel |
citric acid |
|
| subClassOf |