loading...| Preferred Name |
gamma-aminobutyrate |
|
| Synonyms |
4-Aminobutylate 102.11186 BTCSSZJGUNDROE-UHFFFAOYSA-M 4-Amino-butyrat gamma-aminobutanoate NCCCC([O-])=O InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/p-1 gamma-aminobutyrate anion 4-aminobutanoic acid ion (1-) C4H8NO2 4-aminobutyrate 4-aminobutanoate |
|
| Definitions |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30566 |
|
| database_cross_reference |
KEGG:C00334 Gmelin:559138 Beilstein:3536873 PMID:12509893 Reaxys:3536873 |
|
| definition |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:20317 CHEBI:11961 |
|
| has_exact_synonym |
4-aminobutanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-Aminobutylate 102.11186 BTCSSZJGUNDROE-UHFFFAOYSA-M 4-Amino-butyrat gamma-aminobutanoate NCCCC([O-])=O InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/p-1 gamma-aminobutyrate anion 4-aminobutanoic acid ion (1-) C4H8NO2 4-aminobutyrate |
|
| id |
CHEBI:30566 |
|
| imported from | ||
| is conjugate base of | ||
| label |
gamma-aminobutyrate |
|
| notation |
CHEBI:30566 |
|
| prefLabel |
gamma-aminobutyrate |
|
| subClassOf |