loading...| Preferred Name |
1,8-cineole |
|
| Synonyms |
1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane 1,8-cineole 1,8-Cineole Zineol 154.24932 C[C@@]12CC[C@@H](CC1)C(C)(C)O2 eucalyptol WEEGYLXZBRQIMU-WAAGHKOSSA-N 1,8-epoxy-p-menthane 1,3,3-TRIMETHYL-2-OXABICYCLO[2.2.2]OCTANE 1,8-oxido-p-menthane cajeputol InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ 1,8-Cineol C10H18O cineole |
|
| Definitions |
A cineole that has formula C10H18O. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27961 |
|
| database_cross_reference |
CAS:470-82-6 Beilstein:105109 Gmelin:131076 Beilstein:5239941 KEGG:D04115 KEGG:C09844 Wikipedia:Eucalyptol KNApSAcK:C00000136 DrugBank:DB03852 PDBeChem:CNL |
|
| definition |
A cineole that has formula C10H18O. |
|
| has role | ||
| has_alternative_id |
CHEBI:18956 CHEBI:41535 CHEBI:23242 CHEBI:35814 CHEBI:561 |
|
| has_exact_synonym |
1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane 1,8-cineole 1,8-Cineole |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Zineol 154.24932 C[C@@]12CC[C@@H](CC1)C(C)(C)O2 eucalyptol WEEGYLXZBRQIMU-WAAGHKOSSA-N 1,8-epoxy-p-menthane 1,3,3-TRIMETHYL-2-OXABICYCLO[2.2.2]OCTANE 1,8-oxido-p-menthane cajeputol InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ 1,8-Cineol C10H18O cineole |
|
| id |
CHEBI:27961 |
|
| imported from | ||
| label |
1,8-cineole |
|
| notation |
CHEBI:27961 |
|
| prefLabel |
1,8-cineole |
|
| subClassOf |