Jump to:
loading...| Preferred Name | p-menthan-3-ol | |
| Synonyms |
CC(C)C1CCC(C)CC1O 156.26520 C10H20O InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3 NOOLISFMXDJSKH-UHFFFAOYSA-N |
|
| Definitions |
Any secondary alcohol that is one of the eight possible diastereoisomers of 5-methyl-2-(propan-2-yl)cyclohexan-1-ol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25187 |
|
| definition |
Any secondary alcohol that is one of the eight possible diastereoisomers of 5-methyl-2-(propan-2-yl)cyclohexan-1-ol. |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CC(C)C1CCC(C)CC1O 156.26520 C10H20O InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3 NOOLISFMXDJSKH-UHFFFAOYSA-N |
|
| id |
CHEBI:25187 |
|
| imported from | ||
| label |
p-menthan-3-ol |
|
| notation |
CHEBI:25187 |
|
| prefLabel |
p-menthan-3-ol |
|
| subClassOf |
Create mapping