loading...| Preferred Name | succinic acid | |
| Synonyms |
Dihydrofumaric acid acide succinique Butandisaeure InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) asuccin acidum succinicum 118.08800 KDYFGRWQOYBRFD-UHFFFAOYSA-N Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid OC(=O)CCC(O)=O amber acid acide butanedioique 1,2-ethanedicarboxylic acid E363 C4H6O4 spirit of amber Bernsteinsaeure butanedioic acid SUCCINIC ACID succinic acid Succinic acid |
|
| Definitions |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15741 |
|
| database_cross_reference |
MetaCyc:SUC Reaxys:1754069 PMID:17439666 HMDB:HMDB00254 CAS:110-15-6 KEGG:C00042 Wikipedia:Succinic_acid LIPID_MAPS_instance:LMFA01170043 ECMDB:ECMDB00254 DrugBank:DB00139 PDBeChem:SIN Beilstein:1754069 Gmelin:2785 YMDB:YMDB00338 KNApSAcK:C00001205 |
|
| definition |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_66987 http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:9304 CHEBI:22943 CHEBI:45639 CHEBI:26807 |
|
| has_exact_synonym |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Dihydrofumaric acid acide succinique Butandisaeure InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) asuccin acidum succinicum 118.08800 KDYFGRWQOYBRFD-UHFFFAOYSA-N Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid OC(=O)CCC(O)=O amber acid acide butanedioique 1,2-ethanedicarboxylic acid E363 C4H6O4 spirit of amber Bernsteinsaeure |
|
| id |
CHEBI:15741 |
|
| imported from | ||
| is conjugate acid of | ||
| label |
succinic acid |
|
| notation |
CHEBI:15741 |
|
| prefLabel |
succinic acid |
|
| subClassOf |