Preferred Name |
clopidogrel |
|
Synonyms |
|
|
Definitions |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group, the methylene hydrogen of which is replaced by a methoxycarbonyl group (the S enantiomer). A P2Y12 receptor antagonist, it is used to inhibit blood clots and prevent heart attacks. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_37941 |
|
charge |
0 |
|
definition |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group, the methylene hydrogen of which is replaced by a methoxycarbonyl group (the S enantiomer). A P2Y12 receptor antagonist, it is used to inhibit blood clots and prevent heart attacks. |
|
formula |
C16H16ClNO2S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50249 |
|
has_functional_parent | ||
inchi |
InChI=1S/C16H16ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h2-5,7,9,15H,6,8,10H2,1H3/t15-/m0/s1 |
|
inchikey |
GKTWGGQPFAXNFI-HNNXBMFYSA-N |
|
label |
clopidogrel |
|
mass |
321.82200 |
|
monoisotopicmass |
321.05903 |
|
prefixIRI |
CHEBI:37941 |
|
prefLabel |
clopidogrel |
|
smiles |
COC(=O)[C@@H](N1CCc2sccc2C1)c1ccccc1Cl |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 |