Jump to:
loading...| Preferred Name |
nicotinate |
|
| Synonyms |
|
|
| Definitions |
A pyridinemonocarboxylate that is the conjugate base of nicotinic acid, arising from deprotonation of the carboxy group; major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_32544 |
|
| charge |
-1 |
|
| definition |
A pyridinemonocarboxylate that is the conjugate base of nicotinic acid, arising from deprotonation of the carboxy group; major species at pH 7.3. |
|
| formula |
C6H4NO2 |
|
| has role | ||
| inchi |
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/p-1 |
|
| inchikey |
PVNIIMVLHYAWGP-UHFFFAOYSA-M |
|
| is_conjugate_base_of | ||
| label |
nicotinate |
|
| mass |
122.10150 |
|
| monoisotopicmass |
122.02475 |
|
| prefixIRI |
CHEBI:32544 |
|
| prefLabel |
nicotinate |
|
| smiles |
[O-]C(=O)c1cccnc1 |
|
| subClassOf |
Create mapping