Jump to:
loading...| Preferred Name |
butyric acid |
|
| Synonyms |
|
|
| Definitions |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
| charge |
0 |
|
| definition |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
| formula |
C4H8O2 |
|
| has characteristic | ||
| has role | ||
| inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) |
|
| inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
butyric acid |
|
| mass |
88.10510 |
|
| monoisotopicmass |
88.05243 |
|
| prefixIRI |
CHEBI:30772 |
|
| prefLabel |
butyric acid |
|
| smiles |
CCCC(O)=O |
|
| subClassOf |
Create mapping