Preferred Name |
gamma-aminobutyrate |
|
Synonyms |
|
|
Definitions |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30566 |
|
charge |
-1 |
|
definition |
An gamma-amino acid anion resulting from the deprotonation of the carboxy group of gamma-aminobutyric acid. |
|
formula |
C4H8NO2 |
|
has characteristic | ||
has role | ||
has_functional_parent | ||
inchi |
InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/p-1 |
|
inchikey |
BTCSSZJGUNDROE-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
gamma-aminobutyrate |
|
mass |
102.11186 |
|
monoisotopicmass |
102.05605 |
|
prefixIRI |
CHEBI:30566 |
|
prefLabel |
gamma-aminobutyrate |
|
smiles |
NCCCC([O-])=O |
|
subClassOf |
Create mapping