loading...| Preferred Name |
(R)-adrenaline |
|
| Synonyms |
|
|
| Definitions |
The R-enantiomer of adrenaline. It is a hormone secreted by the adrenal glands resulting in the 'fight-or-flight' response. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28918 |
|
| charge |
0 |
|
| definition |
The R-enantiomer of adrenaline. It is a hormone secreted by the adrenal glands resulting in the 'fight-or-flight' response. |
|
| formula |
C9H13NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35569 http://purl.obolibrary.org/obo/CHEBI_50513 http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_35522 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_24621 |
|
| inchi |
InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 |
|
| inchikey |
UCTWMZQNUQWSLP-VIFPVBQESA-N |
|
| is_conjugate_base_of | ||
| is_enantiomer_of | ||
| label |
(R)-adrenaline |
|
| mass |
183.20440 |
|
| monoisotopicmass |
183.08954 |
|
| prefixIRI |
CHEBI:28918 |
|
| prefLabel |
(R)-adrenaline |
|
| smiles |
CNC[C@H](O)c1ccc(O)c(O)c1 |
|
| subClassOf |