Preferred Name |
methimazole |
|
Synonyms |
1-methyl-1,3-dihydro-2H-imidazole-2-thione Methimazole Favistan tiamazol 1-Methylimidazole-2(3H)-thione 1-METHYL-1,3-DIHYDRO-2H-IMIDAZOLE-2-THIONE thiamazol USAF el-30 Tapazole Danantizol thiamazolum Strumazol Thacapzol thiamazole |
|
Definitions |
A member of the class of imidazoles that it imidazole-2-thione in which a methyl group replaces the hydrogen which is attached to a nitrogen. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50673 |
|
charge |
0 |
|
database_cross_reference |
HMDB:HMDB0014901 Drug_Central:1745 DrugBank:DB00763 Wikipedia:Methimazole PDBeChem:MMZ LINCS:LSM-5646 PMID:17438883 CAS:60-56-0 KEGG:D00401 Beilstein:108646 PMID:7454742 VSDB:1825 MetaCyc:CPD-11282 Reaxys:108646 PMID:24443787 PMID:9172960 |
|
definition |
A member of the class of imidazoles that it imidazole-2-thione in which a methyl group replaces the hydrogen which is attached to a nitrogen. |
|
formula |
C4H6N2S |
|
has exact synonym |
1-methyl-1,3-dihydro-2H-imidazole-2-thione Methimazole |
|
has role | ||
has_alternative_id |
CHEBI:44168 CHEBI:6828 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Favistan tiamazol 1-Methylimidazole-2(3H)-thione 1-METHYL-1,3-DIHYDRO-2H-IMIDAZOLE-2-THIONE thiamazol USAF el-30 Tapazole Danantizol thiamazolum Strumazol Thacapzol thiamazole |
|
id |
CHEBI:50673 |
|
in_subset | ||
inchi |
InChI=1S/C4H6N2S/c1-6-3-2-5-4(6)7/h2-3H,1H3,(H,5,7) |
|
inchikey |
PMRYVIKBURPHAH-UHFFFAOYSA-N |
|
label |
methimazole |
|
mass |
114.16900 |
|
monoisotopicmass |
114.02517 |
|
notation |
CHEBI:50673 |
|
prefLabel |
methimazole |
|
smiles |
Cn1cc[nH]c1=S |
|
subClassOf |