loading...| Preferred Name | testosterone cypionate | |
| Synonyms |
Depo- Testosterone testosterone 17beta-cypionate Testosterone cyclopentylpropionate Testosterone cyclopentanepropionate testosterone 17beta-cyclopentanepropionate testosterone 17beta-cyclopentylpropionate Testosterone cypionate 3-oxoandrost-4-en-17beta-yl 3-cyclopentylpropanoate |
|
| Definitions |
A sterol ester that has formula C27H40O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9463 |
|
| alternative label |
testosterone 17beta-cypionate Testosterone cyclopentylpropionate Testosterone cyclopentanepropionate testosterone 17beta-cyclopentanepropionate testosterone 17beta-cyclopentylpropionate Testosterone cypionate 3-oxoandrost-4-en-17beta-yl 3-cyclopentylpropanoate |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
CAS:58-20-8 Beilstein:3174363 LIPID_MAPS_instance:LMST02020074 Drug_Central:4454 DrugBank:DB00624 KEGG:C08156 KEGG:D00957 |
|
| definition |
A sterol ester that has formula C27H40O3. |
|
| formula |
C27H40O3 |
|
| has exact synonym |
Testosterone cypionate 3-oxoandrost-4-en-17beta-yl 3-cyclopentylpropanoate |
|
| has functional parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
testosterone 17beta-cypionate Testosterone cyclopentylpropionate Testosterone cyclopentanepropionate testosterone 17beta-cyclopentanepropionate testosterone 17beta-cyclopentylpropionate |
|
| id |
CHEBI:9463 |
|
| in_subset | ||
| inchi |
InChI=1S/C27H40O3/c1-26-15-13-20(28)17-19(26)8-9-21-22-10-11-24(27(22,2)16-14-23(21)26)30-25(29)12-7-18-5-3-4-6-18/h17-18,21-24H,3-16H2,1-2H3/t21-,22-,23-,24-,26-,27-/m0/s1 |
|
| inchikey |
HPFVBGJFAYZEBE-ZLQWOROUSA-N |
|
| label |
testosterone cypionate |
|
| mass |
412.60470 |
|
| modifiedDate |
May 21, 2010 |
|
| monoisotopicmass |
412.29775 |
|
| notation |
CHEBI:9463 |
|
| note |
A sterol ester that has formula C27H40O3. |
|
| preferred label |
testosterone cypionate |
|
| prefLabel |
testosterone cypionate |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])OC(=O)CCC1CCCC1 |
|
| synonym |
Depo- Testosterone |
|
| subClassOf |