loading...| Preferred Name | naloxone | |
| Synonyms |
1-N-Allyl-14-hydroxynordihydromorphinone 17-allyl-3,14-dihydroxy-4,5alpha-epoxymorphinan-6-one naloxone naloxonum (-)-naloxone naloxona 3,14-dihydroxy-17-(prop-2-en-1-yl)-4,5alpha-epoxymorphinan-6-one |
|
| Definitions |
A synthetic morphinane alkaloid that is morphinone in which the enone double bond has been reduced to a single bond, the hydrogen at position 14 has been replaced by a hydroxy group, and the methyl group attached to the nitrogen has been replaced by an allyl group. A specific opioid antagonist, it is used (commonly as its hydrochloride salt) to reverse the effects of opioids, both following their use of opioids during surgery and in cases of known or suspected opioid overdose. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7459 |
|
| alternative label |
1-N-Allyl-14-hydroxynordihydromorphinone 17-allyl-3,14-dihydroxy-4,5alpha-epoxymorphinan-6-one naloxone naloxonum (-)-naloxone naloxona 3,14-dihydroxy-17-(prop-2-en-1-yl)-4,5alpha-epoxymorphinan-6-one |
|
| charge |
0 |
|
| database_cross_reference |
PMID:26469689 Beilstein:1089071 Drug_Central:1878 Wikipedia:Naloxone PMID:17023477 CAS:465-65-6 KEGG:C07252 Patent:US3254088 PMID:24868924 PMID:26604818 HMDB:HMDB0015314 KEGG:D08249 PMID:25468814 LINCS:LSM-3504 PMID:26634308 DrugBank:DB01183 Reaxys:1089071 Patent:GB939287 |
|
| definition |
A synthetic morphinane alkaloid that is morphinone in which the enone double bond has been reduced to a single bond, the hydrogen at position 14 has been replaced by a hydroxy group, and the methyl group attached to the nitrogen has been replaced by an allyl group. A specific opioid antagonist, it is used (commonly as its hydrochloride salt) to reverse the effects of opioids, both following their use of opioids during surgery and in cases of known or suspected opioid overdose. |
|
| formula |
C19H21NO4 |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_90755 |
|
| has exact synonym |
3,14-dihydroxy-17-(prop-2-en-1-yl)-4,5alpha-epoxymorphinan-6-one |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_90755 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-N-Allyl-14-hydroxynordihydromorphinone 17-allyl-3,14-dihydroxy-4,5alpha-epoxymorphinan-6-one naloxone naloxonum (-)-naloxone naloxona |
|
| id |
CHEBI:7459 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1 |
|
| inchikey |
UZHSEJADLWPNLE-GRGSLBFTSA-N |
|
| is conjugate base of | ||
| label |
naloxone |
|
| mass |
327.37430 |
|
| monoisotopicmass |
327.14706 |
|
| notation |
CHEBI:7459 |
|
| note |
A synthetic morphinane alkaloid that is morphinone in which the enone double bond has been reduced to a single bond, the hydrogen at position 14 has been replaced by a hydroxy group, and the methyl group attached to the nitrogen has been replaced by an allyl group. A specific opioid antagonist, it is used (commonly as its hydrochloride salt) to reverse the effects of opioids, both following their use of opioids during surgery and in cases of known or suspected opioid overdose. |
|
| preferred label |
naloxone |
|
| prefLabel |
naloxone |
|
| smiles |
Oc1ccc2C[C@H]3N(CC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O)CC=C |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38164 |