loading...| Preferred Name |
lysergic acid diethylamide |
|
| Synonyms |
(8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide Lysergic acid diethylamide D-lysergic acid diethylamide Lysergsaeurediaethylamid LSD 25 N,N-diethyl-D-lysergamide N,N-diethyllysergamide N,N-diethyl-(+)-lysergamide Lysergsaeurediethylamid Lysergide LSD (+)-LSD acid 10-didehydro-N (8R)-9 N-diethyl-6-methylergoline-8-carboxamide |
|
| Definitions |
Street names: blotter, boomers, cubes, microdot, yellow sunshines An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6605 |
|
| comment |
Street names: blotter, boomers, cubes, microdot, yellow sunshines |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
CAS:50-37-3 PMID:11723224 Beilstein:94179 Drug_Central:1621 PMID:24785760 PMID:13952224 PMID:25036425 Wikipedia:Lysergic_acid_diethylamide PMID:8428600 MetaCyc:CPD-14458 Patent:US2774763 PMID:17077317 PMID:24594678 PMID:22898355 Patent:US2736728 PMID:23222128 PMID:9698051 PMID:23423312 Reaxys:94179 PMID:24830180 KEGG:C07542 Patent:US3141887 PMID:16005500 |
|
| definition |
An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
|
| formula |
C20H25N3O |
|
| has characteristic | ||
| has exact synonym |
(8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide Lysergic acid diethylamide |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35499 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
D-lysergic acid diethylamide Lysergsaeurediaethylamid LSD 25 N,N-diethyl-D-lysergamide N,N-diethyllysergamide N,N-diethyl-(+)-lysergamide Lysergsaeurediethylamid Lysergide LSD (+)-LSD |
|
| hasStreetName |
boomers microdot cubes blotter yellow sunshines |
|
| id |
CHEBI:6605 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
|
| inchikey |
VAYOSLLFUXYJDT-RDTXWAMCSA-N |
|
| label |
lysergic acid diethylamide |
|
| mass |
323.43200 |
|
| modifiedDate |
June 30, 2010 |
|
| monoisotopicmass |
323.19976 |
|
| notation |
CHEBI:6605 |
|
| prefLabel |
lysergic acid diethylamide |
|
| smiles |
[H][C@@]12Cc3c[nH]c4cccc(C1=C[C@H](CN2C)C(=O)N(CC)CC)c34 |
|
| synonym |
acid 10-didehydro-N (8R)-9 N-diethyl-6-methylergoline-8-carboxamide |
|
| subClassOf |
http://uri.neuinfo.org/nif/nifstd/nlx_chem_1003011 http://purl.obolibrary.org/obo/CHEBI_60529 |