loading...| Preferred Name | hexobarbital | |
| Synonyms |
5-(1-cyclohexen-1-yl)-1,5-dimethylbarbituric acid 5-Cyclohex-1-enyl-1,5-dimethyl-pyrimidine-2,4,6-trione 5-(1-cyclohexen-1-yl)-1,5-dimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione methexenyl methylhexabital Hexobarbitone Evipan 5-(cyclohex-1-en-1-yl)-1,5-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione Hexobarbital |
|
| Definitions |
A member of the class of barbiturates taht is barbituric acid substituted at N-1 by methyl and at C-5 by methyl and cyclohex-1-enyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5706 |
|
| alternative label |
5-(1-cyclohexen-1-yl)-1,5-dimethylbarbituric acid 5-Cyclohex-1-enyl-1,5-dimethyl-pyrimidine-2,4,6-trione 5-(1-cyclohexen-1-yl)-1,5-dimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione methexenyl methylhexabital Hexobarbitone Evipan 5-(cyclohex-1-en-1-yl)-1,5-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione Hexobarbital |
|
| charge |
0 |
|
| database_cross_reference |
PMID:10891117 PMID:8255925 Gmelin:282233 PMID:9586853 Wikipedia:Hexobarbital PMID:19863908 PMID:1153616 KEGG:C11723 PMID:3654008 CAS:56-29-1 Reaxys:253102 PMID:15857133 Beilstein:253102 PMID:1680178 HMDB:HMDB0015444 DrugBank:DB01355 PMID:18870124 PMID:15577260 PMID:7614008 PMID:6864729 Drug_Central:1369 KEGG:D01071 |
|
| definition |
A member of the class of barbiturates taht is barbituric acid substituted at N-1 by methyl and at C-5 by methyl and cyclohex-1-enyl groups. |
|
| formula |
C12H16N2O3 |
|
| has exact synonym |
5-(cyclohex-1-en-1-yl)-1,5-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione Hexobarbital |
|
| has functional parent | ||
| has_alternative_id |
CHEBI:102367 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5-(1-cyclohexen-1-yl)-1,5-dimethylbarbituric acid 5-Cyclohex-1-enyl-1,5-dimethyl-pyrimidine-2,4,6-trione 5-(1-cyclohexen-1-yl)-1,5-dimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione methexenyl methylhexabital Hexobarbitone Evipan |
|
| id |
CHEBI:5706 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H16N2O3/c1-12(8-6-4-3-5-7-8)9(15)13-11(17)14(2)10(12)16/h6H,3-5,7H2,1-2H3,(H,13,15,17) |
|
| inchikey |
UYXAWHWODHRRMR-UHFFFAOYSA-N |
|
| label |
hexobarbital |
|
| mass |
236.26712 |
|
| monoisotopicmass |
236.11609 |
|
| notation |
CHEBI:5706 |
|
| note |
A member of the class of barbiturates taht is barbituric acid substituted at N-1 by methyl and at C-5 by methyl and cyclohex-1-enyl groups. |
|
| preferred label |
hexobarbital |
|
| prefLabel |
hexobarbital |
|
| smiles |
CN1C(=O)NC(=O)C(C)(C1=O)C1=CCCCC1 |
|
| subClassOf |