Preferred Name | lormetazepam | |
Synonyms |
3-dihydro-2H-1 Loramet 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1 4-benzodiazepin-2-one Ativan O-Chlorooxazepam O-Chloroxazepam Methyllorazepam 7-Chloro-5-(o-chlorophenyl)-1,3-dihydro-3-hydroxy-1-methyl-2H-1,4-benzodiazepin-2-one N-Methyllorazepam Loramet (TN) 7-Chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one (+-)-Lorazepam lormetazepamum Lorazepam Lormetazepam 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
Definitions |
A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorpophenyl group at the 5-position and a chloro substituent at the 7-position. A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorophenyl group at the 5-position and a chloro substituent at the 7-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_52993 |
|
alternative label |
O-Chlorooxazepam O-Chloroxazepam Methyllorazepam 7-Chloro-5-(o-chlorophenyl)-1,3-dihydro-3-hydroxy-1-methyl-2H-1,4-benzodiazepin-2-one N-Methyllorazepam Loramet (TN) 7-Chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one (+-)-Lorazepam lormetazepamum Lorazepam Lormetazepam 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
charge |
0 |
|
createdDate |
March 5, 2010 |
|
database_cross_reference |
PMID:22792010 Drug_Central:1608 HMDB:HMDB0041919 KEGG:D01657 Beilstein:759821 DrugBank:DB00186 Reaxys:759821 Patent:BE621819 Patent:US3296249 PMID:11198750 CAS:848-75-9 Wikipedia:Lormetazepam |
|
definition |
A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorpophenyl group at the 5-position and a chloro substituent at the 7-position. A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorophenyl group at the 5-position and a chloro substituent at the 7-position. |
|
formula |
C16H12Cl2N2O2 |
|
has characteristic | ||
has exact synonym |
Lormetazepam 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
has role | ||
has_alternative_id |
CHEBI:31782 CHEBI:52992 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
O-Chlorooxazepam O-Chloroxazepam Methyllorazepam 7-Chloro-5-(o-chlorophenyl)-1,3-dihydro-3-hydroxy-1-methyl-2H-1,4-benzodiazepin-2-one N-Methyllorazepam Loramet (TN) 7-Chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one (+-)-Lorazepam lormetazepamum Lorazepam |
|
id |
CHEBI:52993 |
|
in_subset | ||
inchi |
InChI=1S/C16H12Cl2N2O2/c1-20-13-7-6-9(17)8-11(13)14(19-15(21)16(20)22)10-4-2-3-5-12(10)18/h2-8,15,21H,1H3 |
|
inchikey |
FJIKWRGCXUCUIG-UHFFFAOYSA-N |
|
label |
lormetazepam |
|
mass |
335.18500 |
|
modifiedDate |
May 21, 2010 |
|
monoisotopicmass |
334.02758 |
|
notation |
CHEBI:52993 |
|
note |
A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorpophenyl group at the 5-position and a chloro substituent at the 7-position. A 1,4-benzodiazepinone compound having a methyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-chlorophenyl group at the 5-position and a chloro substituent at the 7-position. |
|
preferred label |
lormetazepam |
|
prefLabel |
lormetazepam |
|
smiles |
CN1C(=O)C(O)N=C(c2ccccc2Cl)c2cc(Cl)ccc12 |
|
synonym |
3-dihydro-2H-1 Loramet 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1 4-benzodiazepin-2-one Ativan |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36683 |