loading...| Preferred Name | alprenolol | |
| Synonyms |
alprenololum 1-(2-Allylphenoxy)-3-isopropylamino-2-propanol alprenolol 1-(o-Allylphenoxy)-3-(isopropylamino)-2-propanol Alfeprol 1-[2-(propen-2-ylphenoxy)]-3-(isopropylamino)propan-2-ol |
|
| Definitions |
A secondary alcohol that is propan-2-ol substituted by a 2-allylphenoxy group at position 1 and an isopropylamino group at position 3. It is a beta-adrenergic antagonist used as a antihypertensive, anti-arrhythmia and a sympatholytic agent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51211 |
|
| alternative label |
alprenololum 1-(2-Allylphenoxy)-3-isopropylamino-2-propanol alprenolol 1-(o-Allylphenoxy)-3-(isopropylamino)-2-propanol Alfeprol 1-[2-(propen-2-ylphenoxy)]-3-(isopropylamino)propan-2-ol |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00866 Wikipedia:Alprenolol Reaxys:1913441 PMID:22841109 Patent:NL6612958 CAS:13655-52-2 LINCS:LSM-1238 HMDB:HMDB0015004 PMID:21958537 Beilstein:1913441 PMID:19203609 Drug_Central:137 Patent:NL6605692 PMID:19882938 KEGG:D07156 |
|
| definition |
A secondary alcohol that is propan-2-ol substituted by a 2-allylphenoxy group at position 1 and an isopropylamino group at position 3. It is a beta-adrenergic antagonist used as a antihypertensive, anti-arrhythmia and a sympatholytic agent. |
|
| formula |
C15H23NO2 |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_66991 |
|
| has exact synonym |
1-[2-(propen-2-ylphenoxy)]-3-(isopropylamino)propan-2-ol |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_66991 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alprenololum 1-(2-Allylphenoxy)-3-isopropylamino-2-propanol alprenolol 1-(o-Allylphenoxy)-3-(isopropylamino)-2-propanol Alfeprol |
|
| id |
CHEBI:51211 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 |
|
| inchikey |
PAZJSJFMUHDSTF-UHFFFAOYSA-N |
|
| label |
alprenolol |
|
| mass |
249.34866 |
|
| monoisotopicmass |
249.17288 |
|
| notation |
CHEBI:51211 |
|
| note |
A secondary alcohol that is propan-2-ol substituted by a 2-allylphenoxy group at position 1 and an isopropylamino group at position 3. It is a beta-adrenergic antagonist used as a antihypertensive, anti-arrhythmia and a sympatholytic agent. |
|
| preferred label |
alprenolol |
|
| prefLabel |
alprenolol |
|
| smiles |
CC(C)NCC(O)COc1ccccc1CC=C |
|
| subClassOf |