loading...| Preferred Name |
DOPA |
|
| Synonyms |
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid dopa 3-hydroxytyrosine dl-beta-(3,4-dihydroxyphenyl)-alpha-alanine DL-beta-(3,4-dihydroxyphenyl)alanine DL-3,4-dopa 3-hydroxy-DL-tyrosine (+-)-dopa 3',4'-dihydroxyphenylalanine beta-(3,4-dihydroxyphenyl)-DL-alpha-alanine (R,S)-dopa DL-dihydroxyphenylalanine DL-dioxyphenylalanine (+-)-3-(3,4-dihydroxyphenyl)alanine |
|
| Definitions |
is a naturally-occurring dietary supplement and psychoactive drug found in certain kinds of food and herbs (e.g., Mucuna pruriens, or velvet bean), and is synthesized from the essential amino acid L-tyrosine (TYR) in the mammalian body and brain. (From Wikipedia) A hydroxyphenylalanine carrying hydroxy substituents at positions 3 and 4 of the benzene ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_49168 |
|
| charge |
0 |
|
| createdDate |
May 5, 2010 |
|
| database_cross_reference |
CAS:63-84-3 PMID:24117106 Reaxys:1462084 HMDB:HMDB0000609 Gmelin:51382 Beilstein:1462084 |
|
| definition |
is a naturally-occurring dietary supplement and psychoactive drug found in certain kinds of food and herbs (e.g., Mucuna pruriens, or velvet bean), and is synthesized from the essential amino acid L-tyrosine (TYR) in the mammalian body and brain. (From Wikipedia) |
|
| formula |
C9H11NO4 |
|
| has exact synonym |
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid dopa |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-hydroxytyrosine dl-beta-(3,4-dihydroxyphenyl)-alpha-alanine DL-beta-(3,4-dihydroxyphenyl)alanine DL-3,4-dopa 3-hydroxy-DL-tyrosine (+-)-dopa 3',4'-dihydroxyphenylalanine beta-(3,4-dihydroxyphenyl)-DL-alpha-alanine (R,S)-dopa DL-dihydroxyphenylalanine DL-dioxyphenylalanine (+-)-3-(3,4-dihydroxyphenyl)alanine |
|
| id |
CHEBI:49168 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14) |
|
| inchikey |
WTDRDQBEARUVNC-UHFFFAOYSA-N |
|
| label |
dopa DOPA |
|
| mass |
197.18798 |
|
| monoisotopicmass |
197.06881 |
|
| notation |
CHEBI:49168 |
|
| prefLabel |
DOPA |
|
| smiles |
NC(Cc1ccc(O)c(O)c1)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24734 |