Preferred Name |
ergoline |
|
Synonyms |
ergoline (2R,7R)-6,11-diazatetracyclo[7.6.1.0(2,7).0(12,16)]hexadeca-1(16),9,12,14-tetraene ergoline I (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (6aR-trans)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|
Definitions |
An indole alkaloid whose structural skeleton is found in many naturally occurring and synthetic ergolines which are known to bind to neurotransmitter receptors, such as dopamine, noradrenaline and serotonin receptors and function as unselective agonists or antagonists at these receptors. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_38484 |
|
charge |
0 |
|
database_cross_reference |
PMID:423180 PMID:19783143 PMID:16944356 Wikipedia:Ergoline CAS:478-88-6 PMID:31621316 PMID:13217 PMID:18031017 Chemspider:5256873 PMID:23659323 |
|
definition |
An indole alkaloid whose structural skeleton is found in many naturally occurring and synthetic ergolines which are known to bind to neurotransmitter receptors, such as dopamine, noradrenaline and serotonin receptors and function as unselective agonists or antagonists at these receptors. |
|
formula |
C14H16N2 |
|
has exact synonym |
ergoline |
|
has_alternative_id |
CHEBI:23326 CHEBI:35503 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(2R,7R)-6,11-diazatetracyclo[7.6.1.0(2,7).0(12,16)]hexadeca-1(16),9,12,14-tetraene ergoline I (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (6aR-trans)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|
id |
CHEBI:38484 |
|
in_subset | ||
inchi |
InChI=1S/C14H16N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1,3,5,8,10,13,15-16H,2,4,6-7H2/t10-,13-/m1/s1 |
|
inchikey |
RHGUXDUPXYFCTE-ZWNOBZJWSA-N |
|
label |
ergoline |
|
mass |
212.29032 |
|
monoisotopicmass |
212.13135 |
|
notation |
CHEBI:38484 |
|
prefLabel |
ergoline |
|
smiles |
[H][C@@]12Cc3c[nH]c4cccc(c34)[C@@]1([H])CCCN2 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38482 http://purl.obolibrary.org/obo/CHEBI_38958 http://purl.obolibrary.org/obo/CHEBI_60529 |