Preferred Name |
L-methionine |
|
Synonyms |
L-Methionine L-methionine L-(-)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid Met L-Methionin (S)-methionine METHIONINE (S)-2-amino-4-(methylthio)butyric acid (S)-2-amino-4-(methylthio)butanoic acid (2S)-2-amino-4-(methylsulfanyl)butanoic acid M Methionine |
|
Definitions |
The L-enantiomer of methionine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16643 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00134 MetaCyc:MET KEGG:D00019 Reaxys:1722294 PMID:21946918 PMID:22517898 Drug_Central:3347 KEGG:C00073 KNApSAcK:C00001379 PMID:16575097 PMID:22200379 HMDB:HMDB0000696 PDBeChem:MET_LFOH Gmelin:26935 YMDB:YMDB00318 PMID:22370952 PMID:24939187 ECMDB:ECMDB00696 PMID:5764336 PMID:24126240 PMID:21683740 PMID:22448874 CAS:63-68-3 |
|
definition |
The L-enantiomer of methionine. |
|
formula |
C5H11NO2S |
|
has exact synonym |
L-Methionine L-methionine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_74529 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:13141 CHEBI:21360 CHEBI:43990 CHEBI:6271 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
L-(-)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid Met L-Methionin (S)-methionine METHIONINE (S)-2-amino-4-(methylthio)butyric acid (S)-2-amino-4-(methylthio)butanoic acid (2S)-2-amino-4-(methylsulfanyl)butanoic acid M Methionine |
|
id |
CHEBI:16643 |
|
in_subset | ||
inchi |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
|
inchikey |
FFEARJCKVFRZRR-BYPYZUCNSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-methionine |
|
mass |
149.21238 |
|
monoisotopicmass |
149.05105 |
|
notation |
CHEBI:16643 |
|
prefLabel |
L-methionine |
|
smiles |
CSCC[C@H](N)C(O)=O |
|
subClassOf |