loading...| Preferred Name |
lipoic acid |
|
| Synonyms |
Lipoic acid 5-(1,2-dithiolan-3-yl)pentanoic acid 6,8-thiotic acid 5-(dithiolan-3-yl)valeric acid 1,2-dithiolane-3-pentanoic acid 6-thiotic acid Thioctic acid 6,8-thioctic acid Thioctansaeure 5-[3-(1,2-dithiolanyl)]pentanoic acid Thioktsaeure 5-(1,2-dithiolan-3-yl)valeric acid Acetate-replacing factor Biletan 1,2-dithiolane-3-valeric acid Thioctsaeure alpha-Liponsaeure 6-thioctic acid alpha-lipoic acid alpha-Lipoic acid liponic acid |
|
| Definitions |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16494 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:81853 PMID:7548757 Drug_Central:4732 KEGG:D00086 Beilstein:122410 Wikipedia:Lipoic_acid KEGG:C00725 Beilstein:81853 CAS:62-46-4 DrugBank:DB00166 PMID:15328413 PMID:7519986 ECMDB:ECMDB01451 Gmelin:720915 YMDB:YMDB00334 |
|
| definition |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
| formula |
C8H14O2S2 |
|
| has exact synonym |
Lipoic acid 5-(1,2-dithiolan-3-yl)pentanoic acid |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:25058 CHEBI:6492 CHEBI:146958 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
6,8-thiotic acid 5-(dithiolan-3-yl)valeric acid 1,2-dithiolane-3-pentanoic acid 6-thiotic acid Thioctic acid 6,8-thioctic acid Thioctansaeure 5-[3-(1,2-dithiolanyl)]pentanoic acid Thioktsaeure 5-(1,2-dithiolan-3-yl)valeric acid Acetate-replacing factor Biletan 1,2-dithiolane-3-valeric acid Thioctsaeure alpha-Liponsaeure 6-thioctic acid alpha-lipoic acid alpha-Lipoic acid liponic acid |
|
| id |
CHEBI:16494 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) |
|
| inchikey |
AGBQKNBQESQNJD-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
lipoic acid |
|
| mass |
206.32756 |
|
| monoisotopicmass |
206.04352 |
|
| notation |
CHEBI:16494 |
|
| prefLabel |
lipoic acid |
|
| smiles |
OC(=O)CCCCC1CCSS1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_39192 |