loading...| Preferred Name | Coumarin | |
| Synonyms |
1,2-Benzopyrone Chromen-2-one Tonka bean camphor Tonka Bean Camphor 2H-1-Benzopyran-2-one COUMARIN Coumarin coumarin |
|
| Definitions |
O hydroxycinnamic acid. Pleasant smelling compound found in many plants and released on wilting. Has anticoagulant activity by competing with Vitamin K. |
|
| ID |
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C397 |
|
| ALT_DEFINITION |
A substance used to make drugs that prevent and treat blood clots in blood vessels and treat certain heart conditions. Coumarin is taken from certain plants and can also be made in the laboratory. It is a type of anticoagulant. A class of organic compounds containing a benzopyrone (a bicyclic structure of phenyl ring fused to a second-6 member ring that has five carbons, an oxygen atom at the 1 position, and a ketone attachment at the 2 position). Also refers to the simplest coumarin compound H-benzopyran-one (C9H6O2). the chemical structure is C1=CC=C2C(=C1)C=CC(=O)O2. |
|
| CAS_Registry |
91-64-5 |
|
| CHEBI_ID |
CHEBI:28794 |
|
| Chemical_Formula |
C9H6O2 |
|
| code |
C397 |
|
| Concept_In_Subset | ||
| Contributing_Source |
CRCH FDA |
|
| DEFINITION |
O hydroxycinnamic acid. Pleasant smelling compound found in many plants and released on wilting. Has anticoagulant activity by competing with Vitamin K. |
|
| FDA_UNII_Code |
A4VZ22K1WT |
|
| FULL_SYN |
1,2-Benzopyrone Chromen-2-one Tonka bean camphor Tonka Bean Camphor 2H-1-Benzopyran-2-one COUMARIN Coumarin coumarin |
|
| label |
Coumarin |
|
| Legacy Concept Name |
Coumarin |
|
| NCI_Drug_Dictionary_ID |
42491 |
|
| NSC Number |
8774 |
|
| PDQ_Closed_Trial_Search_ID |
42491 |
|
| PDQ_Open_Trial_Search_ID |
42491 |
|
| Preferred_Name |
Coumarin |
|
| prefixIRI |
Thesaurus:C397 |
|
| Semantic_Type |
Organic Chemical Pharmacologic Substance |
|
| UMLS_CUI |
C0010206 |
|
| subClassOf |