Link to this page
Microbial Conditions Ontology
| Preferred Name | ursodeoxycholic acid | |
| Synonyms |
Ursodiol InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 C24H40O4 [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@@H](O)C2)[C@H](C)CCC(O)=O 3alpha,7beta-Dihydroxy-5beta-cholan-24-oic acid Ursodeoxycholate RUDATBOHQWOJDD-UZVSRGJWSA-N 392.293 392.57200 (3alpha,5beta,7beta)-3,7-dihydroxycholan-24-oic acid Actigall 0 Ursodeoxycholic acid 3alpha,7beta-dihydroxy-5beta-cholan-24-oic acid |
|
| Definitions |
A bile acid found in the bile of bears (Ursidae) as a conjugate with taurine. Used therapeutically, it prevents the synthesis and absorption of cholesterol and can lead to the dissolution of gallstones. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9907 |
|
| database_cross_reference |
Reaxys:3219888 HMDB:HMDB00946 LIPID_MAPS_instance:LMST04010033 PMID:17489439 PMID:24816727 Drug_Central:2797 KEGG:C07880 PMID:14989050 LINCS:LSM-6555 KEGG:D00734 CAS:128-13-2 Beilstein:3219888 Wikipedia:Ursodiol DrugBank:DB01586
|
|
| has exact synonym |
Ursodeoxycholic acid 3alpha,7beta-dihydroxy-5beta-cholan-24-oic acid
|
|
| has role | ||
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Ursodiol InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 C24H40O4 [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@@H](O)C2)[C@H](C)CCC(O)=O 3alpha,7beta-Dihydroxy-5beta-cholan-24-oic acid Ursodeoxycholate RUDATBOHQWOJDD-UZVSRGJWSA-N 392.293 392.57200 (3alpha,5beta,7beta)-3,7-dihydroxycholan-24-oic acid Actigall 0
|
|
| id |
CHEBI:9907
|
|
| in_subset | ||
| is conjugate acid of | ||
| label |
ursodeoxycholic acid
|
|
| notation |
CHEBI:9907
|
|
| prefLabel |
ursodeoxycholic acid
|
|
| textual definition |
A bile acid found in the bile of bears (Ursidae) as a conjugate with taurine. Used therapeutically, it prevents the synthesis and absorption of cholesterol and can lead to the dissolution of gallstones.
|
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_131620 |
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |