Jump to:
loading...| Preferred Name | 2-amino-3-methylpentanoic acid | |
| Synonyms |
C6H13NO2 131.17296 131.095 AGPKZVBTJJNPAG-UHFFFAOYSA-N InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) CCC(C)C(N)C(O)=O 0 2-amino-3-methylpentanoic acid |
|
| Definitions |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38264 |
|
| database_cross_reference |
PMID:10944265 CAS:443-79-8 Reaxys:1721790 KEGG:C16434 |
|
| has exact synonym |
2-amino-3-methylpentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
C6H13NO2 131.17296 131.095 AGPKZVBTJJNPAG-UHFFFAOYSA-N InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) CCC(C)C(N)C(O)=O 0 |
|
| id |
CHEBI:38264 |
|
| in_subset | ||
| label |
2-amino-3-methylpentanoic acid |
|
| notation |
CHEBI:38264 |
|
| prefLabel |
2-amino-3-methylpentanoic acid |
|
| textual definition |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
| subClassOf |
Create mapping