Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
| Preferred Name | penicillanic acid | |
| Synonyms |
InChI=1S/C8H11NO3S/c1-8(2)6(7(11)12)9-4(10)3-5(9)13-8/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 C8H11NO3S RBKMMJSQKNKNEV-RITPCOANSA-N (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 201.046 201.24388 [H][C@@]12CC(=O)N1[C@@H](C(O)=O)C(C)(C)S2 0 penicillanic acid 2,2-dimethylpenam-3alpha-carboxylic acid |
|
| Definitions |
A penam that consists of 3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane bearing a carboxy group at position 2 and having (2S,5R)-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_37806 |
|
| database_cross_reference |
Reaxys:4677775 CAS:87-53-6 Beilstein:4677775
|
|
| has exact synonym |
penicillanic acid 2,2-dimethylpenam-3alpha-carboxylic acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
InChI=1S/C8H11NO3S/c1-8(2)6(7(11)12)9-4(10)3-5(9)13-8/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 C8H11NO3S RBKMMJSQKNKNEV-RITPCOANSA-N (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 201.046 201.24388 [H][C@@]12CC(=O)N1[C@@H](C(O)=O)C(C)(C)S2 0
|
|
| id |
CHEBI:37806
|
|
| in_subset | ||
| label |
penicillanic acid
|
|
| notation |
CHEBI:37806
|
|
| prefLabel |
penicillanic acid
|
|
| textual definition |
A penam that consists of 3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane bearing a carboxy group at position 2 and having (2S,5R)-configuration.
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping