Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
| Preferred Name | D-gluconic acid | |
| Synonyms |
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid D-gluco-Hexonic acid OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O C6H12O7 D-Gluconsaeure Maltonic acid 196.058 Glycogenic acid GLUCONIC ACID Hexonic acid RGHNJXZEOKUKBD-SQOUGZDYSA-N Dextronic acid InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 D-Glukonsaeure Gluconic acid 196.15528 0 D-Gluconic acid D-gluconic acid |
|
| Definitions |
A gluconic acid having D-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_33198 |
|
| database_cross_reference |
PMID:21424687 Reaxys:1726055 Beilstein:1726055 PMID:19577953 KEGG:C00257 PMID:22770225 PMID:24024763 PMID:17439666 HMDB:HMDB00625 PMID:22352719 PMID:22541639 PMID:20222845 PDBeChem:GCO Gmelin:83545 Wikipedia:Gluconic_acid PMID:21086198 Drug_Central:3264 PMID:22688246 MetaCyc:GLUCONATE KNApSAcK:C00007303 CAS:526-95-4 PMID:21819772 PMID:11777404
|
|
| has exact synonym |
D-Gluconic acid D-gluconic acid
|
|
| has role | ||
| has_alternative_id |
CHEBI:20986 CHEBI:42715 CHEBI:4157
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid D-gluco-Hexonic acid OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O C6H12O7 D-Gluconsaeure Maltonic acid 196.058 Glycogenic acid GLUCONIC ACID Hexonic acid RGHNJXZEOKUKBD-SQOUGZDYSA-N Dextronic acid InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 D-Glukonsaeure Gluconic acid 196.15528 0
|
|
| id |
CHEBI:33198
|
|
| in_subset | ||
| is conjugate acid of | ||
| is enantiomer of | ||
| label |
D-gluconic acid
|
|
| notation |
CHEBI:33198
|
|
| prefLabel |
D-gluconic acid
|
|
| textual definition |
A gluconic acid having D-configuration.
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping