loading...| Preferred Name | serine | |
| Synonyms |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) MTCFGRXMJLQNBG-UHFFFAOYSA-N C3H7NO3 105.09262 Serin 105.043 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid 2-Amino-3-hydroxypropionic acid NC(CO)C(O)=O 0 Serine serine |
|
| Definitions |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
|
| database_cross_reference |
Reaxys:1721402 KNApSAcK:C00001393 Gmelin:26429 CAS:302-84-1 Wikipedia:Serine Beilstein:1721402 KEGG:C00716 |
|
| has biological role in Escherichia coli | ||
| has exact synonym |
Serine serine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:26648 CHEBI:15081 CHEBI:9116 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) MTCFGRXMJLQNBG-UHFFFAOYSA-N C3H7NO3 105.09262 Serin 105.043 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid 2-Amino-3-hydroxypropionic acid NC(CO)C(O)=O 0 |
|
| id |
CHEBI:17822 |
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
serine |
|
| notation |
CHEBI:17822 |
|
| prefLabel |
serine |
|
| textual definition |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
| subClassOf |