Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
| Preferred Name | dihydroxyacetone | |
| Synonyms |
90.078 Bis(hydroxymethyl) ketone 1,3-Dihydroxypropanone 1,3-Dihydroxy-2-propanone RXKJFZQQPQGTFL-UHFFFAOYSA-N 1,3-propanediol-2-one DHA alpha,alpha'-dihydroxyacetone 1,3-Dihydroxyacetone 1,3-Dihydroxypropan-2-one InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2 1,3-Dihydroxydimethyl ketone 90.032 C3H6O3 Glycerone 0 C(CO)(CO)=O dihydroxyacetone Dihydroxyacetone DIHYDROXYACETONE 1,3-dihydroxypropan-2-one |
|
| Definitions |
A ketotriose consisting of acetone bearing hydroxy substituents at positions 1 and 3. The simplest member of the class of ketoses and the parent of the class of glycerones. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16016 |
|
| database_cross_reference |
Reaxys:1740268 Wikipedia:Dihydroxyacetone PDBeChem:2HA PMID:21598406 PMID:24209782 Beilstein:1740268 PMID:23554234 PMID:23748086 PMID:21549029 KEGG:C00184 MetaCyc:DIHYDROXYACETONE CAS:96-26-4 KEGG:D07841 DrugBank:DB01775 HMDB:HMDB01882 PMID:20936361 PMID:23543734
|
|
| has exact synonym |
dihydroxyacetone Dihydroxyacetone DIHYDROXYACETONE 1,3-dihydroxypropan-2-one
|
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:24354 CHEBI:39809 CHEBI:5453 CHEBI:14340
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
90.078 Bis(hydroxymethyl) ketone 1,3-Dihydroxypropanone 1,3-Dihydroxy-2-propanone RXKJFZQQPQGTFL-UHFFFAOYSA-N 1,3-propanediol-2-one DHA alpha,alpha'-dihydroxyacetone 1,3-Dihydroxyacetone 1,3-Dihydroxypropan-2-one InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2 1,3-Dihydroxydimethyl ketone 90.032 C3H6O3 Glycerone 0 C(CO)(CO)=O
|
|
| id |
CHEBI:16016
|
|
| in_subset | ||
| label |
dihydroxyacetone
|
|
| notation |
CHEBI:16016
|
|
| prefLabel |
dihydroxyacetone
|
|
| textual definition |
A ketotriose consisting of acetone bearing hydroxy substituents at positions 1 and 3. The simplest member of the class of ketoses and the parent of the class of glycerones.
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping