Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
| Preferred Name | 2,3-dihydroxybutanedioic acid | |
| Synonyms |
(2R,3R)-Tartaric acid (R,R)-Tartrate L-Tartaric acid 2,3-dihydroxysuccinic acid InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) 150.08684 FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid (+)-Tartaric acid 150.016 C4H6O6 OC(C(O)C(O)=O)C(O)=O 0 2,3-dihydroxybutanedioic acid |
|
| Definitions |
A tetraric acid that is butanedioic acid substituted by hydroxy groups at positions 2 and 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15674 |
|
| database_cross_reference |
Gmelin:27021 CAS:87-69-4 KEGG:C00898 Reaxys:510169 Wikipedia:Tartaric_Acid KEGG:D00103 KNApSAcK:C00001206
|
|
| has exact synonym |
2,3-dihydroxybutanedioic acid
|
|
| has role | ||
| has_alternative_id |
CHEBI:9404
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
(2R,3R)-Tartaric acid (R,R)-Tartrate L-Tartaric acid 2,3-dihydroxysuccinic acid InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) 150.08684 FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid (+)-Tartaric acid 150.016 C4H6O6 OC(C(O)C(O)=O)C(O)=O 0
|
|
| id |
CHEBI:15674
|
|
| in_subset | ||
| is conjugate acid of | ||
| label |
2,3-dihydroxybutanedioic acid
|
|
| notation |
CHEBI:15674
|
|
| prefLabel |
2,3-dihydroxybutanedioic acid
|
|
| textual definition |
A tetraric acid that is butanedioic acid substituted by hydroxy groups at positions 2 and 3.
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping