Preferred Name |
isobutane |
|
Synonyms |
2-methylpropane isobutane (CH3)2CH-CH3 E943b R-600a |
|
Definitions |
An alkane that is propane substituted by a methyl group at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30363 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:1730720 Gmelin:1301 Wikipedia:Isobutane PMID:24179026 CAS:75-28-5 PMID:24464945 Beilstein:1730720 KEGG:D04623 |
|
definition |
An alkane that is propane substituted by a methyl group at position 2. |
|
formula |
C4H10 |
|
has role | ||
has_exact_synonym |
2-methylpropane isobutane |
|
has_related_synonym |
(CH3)2CH-CH3 E943b R-600a |
|
hasOBONamespace |
chebi_ontology |
|
id |
CHEBI:30363 |
|
inchi |
InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 |
|
inchikey |
NNPPMTNAJDCUHE-UHFFFAOYSA-N |
|
inSubset | ||
label |
isobutane |
|
mass |
58.12220 |
|
monoisotopicmass |
58.07825 |
|
notation |
CHEBI:30363 |
|
prefLabel |
isobutane |
|
smiles |
CC(C)C |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_138675 |
Create mapping