Preferred Name |
thiethylperazine |
|
Synonyms |
Thiethylperazine 2-(ethylsulfanyl)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine Ethylthioperazine thiethylperazine thiethylperazinum tietilperazina 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine 3-Ethylmercapto-10-(1'-methylpiperazinyl-4'-propyl)phenothiazine |
|
Definitions |
A member of the class of phenothiazines that is perazine substituted by a ethylsulfanyl group at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9544 |
|
charge |
0 |
|
chemical has protein target as antagonist | ||
database_cross_reference |
Beilstein:52127 DrugBank:DB00372 CAS:1420-55-9 PMID:23243946 Reaxys:52127 KEGG:C07132 Drug_Central:2630 Wikipedia:Thiethylperazine KEGG:D02354 PMID:15469457 LINCS:LSM-3556 HMDB:HMDB0014516 |
|
definition |
A member of the class of phenothiazines that is perazine substituted by a ethylsulfanyl group at position 2. |
|
definition source | ||
formula |
C22H29N3S2 |
|
has exact synonym |
Thiethylperazine 2-(ethylsulfanyl)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_37930 http://purl.obolibrary.org/obo/CHEBI_37956 http://purl.obolibrary.org/obo/CHEBI_48876 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Ethylthioperazine thiethylperazine thiethylperazinum tietilperazina 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine 3-Ethylmercapto-10-(1'-methylpiperazinyl-4'-propyl)phenothiazine |
|
id |
CHEBI:9544 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C22H29N3S2/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24/h4-5,7-10,17H,3,6,11-16H2,1-2H3 |
|
inchikey |
XCTYLCDETUVOIP-UHFFFAOYSA-N |
|
label |
thiethylperazine |
|
mass |
399.61788 |
|
monoisotopicmass |
399.18029 |
|
notation |
CHEBI:9544 |
|
prefLabel |
thiethylperazine |
|
smiles |
CCSc1ccc2Sc3ccccc3N(CCCN3CCN(C)CC3)c2c1 |
|
subClassOf |