Preferred Name | astemizole | |
Synonyms |
astemizole astemizol 1-(p-Fluorobenzyl)-2-((1-(2-(p-methoxyphenyl)ethyl)piperid-4-yl)amino)benzimidazole astemizolum 1-(p-Fluorobenzyl)-2-((1-(p-methoxyphenethyl)-4-piperidyl)amino)benzimidazole Astemison 1-(4-fluorobenzyl)-N-{1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl}-1H-benzimidazol-2-amine |
|
Definitions |
A piperidine compound having a 2-(4-methoxyphenyl)ethyl group at the 1-position and an N-[(4-fluorobenzyl)benzimidazol-2-yl]amino group at the 4-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2896 |
|
charge |
0 |
|
chemical effective in vitro against virus | ||
chemical has protein target |
http://purl.obolibrary.org/obo/PR_O95259 http://purl.obolibrary.org/obo/PR_P10636 |
|
chemical has protein target as antagonist | ||
chemical has protein target as inhibitor | ||
database_cross_reference |
DrugBank:DB00637 KEGG:D00234 Drug_Central:249 Beilstein:4830190 Patent:EP5318 CAS:68844-77-9 Patent:US4219559 KEGG:C06832 LINCS:LSM-5502 |
|
definition |
A piperidine compound having a 2-(4-methoxyphenyl)ethyl group at the 1-position and an N-[(4-fluorobenzyl)benzimidazol-2-yl]amino group at the 4-position. |
|
definition source |
https://www.drugbank.ca/drugs/DB00637 PMID: 24841273 |
|
formula |
C28H31FN4O |
|
has exact synonym |
1-(4-fluorobenzyl)-N-{1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl}-1H-benzimidazol-2-amine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
astemizole astemizol 1-(p-Fluorobenzyl)-2-((1-(2-(p-methoxyphenyl)ethyl)piperid-4-yl)amino)benzimidazole astemizolum 1-(p-Fluorobenzyl)-2-((1-(p-methoxyphenethyl)-4-piperidyl)amino)benzimidazole Astemison |
|
id |
CHEBI:2896 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C28H31FN4O/c1-34-25-12-8-21(9-13-25)14-17-32-18-15-24(16-19-32)30-28-31-26-4-2-3-5-27(26)33(28)20-22-6-10-23(29)11-7-22/h2-13,24H,14-20H2,1H3,(H,30,31) |
|
inchikey |
GXDALQBWZGODGZ-UHFFFAOYSA-N |
|
label |
astemizole |
|
mass |
458.57030 |
|
monoisotopicmass |
458.24819 |
|
notation |
CHEBI:2896 |
|
prefLabel |
astemizole |
|
smiles |
COc1ccc(CCN2CCC(CC2)Nc2nc3ccccc3n2Cc2ccc(F)cc2)cc1 |
|
subClassOf |