Preferred Name | nimesulide | |
Synonyms |
4'-nitro-2'-phenoxymethanesulfonanilide 4-NITRO-2-PHENOXYMETHANESULFONANILIDE N-(4-nitro-2-phenoxyphenyl)methanesulfonamide Nimesulide |
|
Definitions |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_44445 |
|
database cross reference |
CAS:51803-78-2 Reaxys:2421175 PMID:18426087 Drug_Central:1935 LINCS:LSM-3718 DrugBank:DB04743 Beilstein:2421175 |
|
definition |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
formula |
C13H12N2O5S |
|
has role | ||
has_exact_synonym |
N-(4-nitro-2-phenoxyphenyl)methanesulfonamide Nimesulide |
|
has_related_synonym |
4'-nitro-2'-phenoxymethanesulfonanilide 4-NITRO-2-PHENOXYMETHANESULFONANILIDE |
|
label |
nimesulide |
|
prefixIRI |
CHEBI:44445 |
|
prefLabel |
nimesulide |
|
smiles |
CS(=O)(=O)Nc1ccc(cc1Oc1ccccc1)[N+]([O-])=O |
|
subClassOf |
Create mapping