Jump to:
loading...| Preferred Name | skatole | |
| Synonyms |
3-methyl-4,5-benzopyrrole C9H9N InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 Skatol Cc1c[nH]c2ccccc12 beta-methylindole InChIKey=ZFRKQXVRDFCRJG-UHFFFAOYSA-N 3-Methylindole Skatole 3-methyl-1H-indole |
|
| Definitions |
A methylindole that has formula C9H9N. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9171 |
|
| database_cross_reference |
KEGG COMPOUND:83-34-1 ChemIDplus:83-34-1 Beilstein:111296 KEGG COMPOUND:C08313 NIST Chemistry WebBook:83-34-1 Gmelin:396961 |
|
| definition |
A methylindole that has formula C9H9N. |
|
| has_exact_synonym |
Skatole 3-methyl-1H-indole |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-methyl-4,5-benzopyrrole C9H9N InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 Skatol Cc1c[nH]c2ccccc12 beta-methylindole InChIKey=ZFRKQXVRDFCRJG-UHFFFAOYSA-N 3-Methylindole |
|
| id |
CHEBI:9171 |
|
| imported from | ||
| label |
skatole |
|
| notation |
CHEBI:9171 |
|
| prefixIRI |
CHEBI:9171 |
|
| prefLabel |
skatole |
|
| subClassOf |
Create mapping