Jump to:
loading...| Preferred Name | phenyl acetate | |
| Synonyms |
Acetic acid,phenyl ester InChI=1S/C8H8O2/c1-7(9)10-8-5-3-2-4-6-8/h2-6H,1H3 CC(=O)Oc1ccccc1 C8H8O2 InChIKey=IPBVNPXQWQGGJP-UHFFFAOYSA-N Acetylphenol Phenol acetate phenyl acetate Phenyl acetate |
|
| Definitions |
An acetate ester that has formula C8H8O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8082 |
|
| database_cross_reference |
Beilstein:636458 KEGG COMPOUND:122-79-2 KEGG COMPOUND:C00548 NIST Chemistry WebBook:122-79-2 |
|
| definition |
An acetate ester that has formula C8H8O2. |
|
| has_exact_synonym |
phenyl acetate Phenyl acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Acetic acid,phenyl ester InChI=1S/C8H8O2/c1-7(9)10-8-5-3-2-4-6-8/h2-6H,1H3 CC(=O)Oc1ccccc1 C8H8O2 InChIKey=IPBVNPXQWQGGJP-UHFFFAOYSA-N Acetylphenol Phenol acetate |
|
| id |
CHEBI:8082 |
|
| imported from | ||
| label |
phenyl acetate |
|
| notation |
CHEBI:8082 |
|
| prefixIRI |
CHEBI:8082 |
|
| prefLabel |
phenyl acetate |
|
| subClassOf |
Create mapping