loading...| Preferred Name | 4-aminobenzoic acid | |
| Synonyms |
ABEE p-aminobenzoic acid Nc1ccc(cc1)C(O)=O para-aminobenzoic acid C7H7NO2 InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-N p-Aminobenzoesaeure InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) 4-Aminobenzoesaeure PABA 4-Amino-benzoic acid 4-aminobenzoic acid 4-AMINOBENZOIC ACID 4-Aminobenzoic acid |
|
| Definitions |
An aminobenzoic acid that has formula C7H7NO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30753 |
|
| database_cross_reference |
KEGG COMPOUND:150-13-0 ChEMBL:3950915 KEGG COMPOUND:C00568 ChEMBL:15115392 ChEMBL:12039592 ChEMBL:17149871 PDBeChem:PAB ChEMBL:9406595 DrugBank:DB02362 CiteXplore:19469519 Wikipedia:4-Aminobenzoic_Acid NIST Chemistry WebBook:150-13-0 ChemIDplus:150-13-0 Gmelin:50150 ChEMBL:8411009 ChEMBL:3820215 ChEMBL:1527790 ChEMBL:16290145 ChEMBL:3599019 Beilstein:471605 |
|
| definition |
An aminobenzoic acid that has formula C7H7NO2. |
|
| has_alternative_id |
CHEBI:20315 CHEBI:44778 CHEBI:1783 CHEBI:113372 |
|
| has_exact_synonym |
4-aminobenzoic acid 4-AMINOBENZOIC ACID 4-Aminobenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ABEE p-aminobenzoic acid Nc1ccc(cc1)C(O)=O para-aminobenzoic acid C7H7NO2 InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-N p-Aminobenzoesaeure InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) 4-Aminobenzoesaeure PABA 4-Amino-benzoic acid |
|
| id |
CHEBI:30753 |
|
| imported from | ||
| label |
4-aminobenzoic acid |
|
| notation |
CHEBI:30753 |
|
| prefixIRI |
CHEBI:30753 |
|
| prefLabel |
4-aminobenzoic acid |
|
| subClassOf |