Link to this page
Human Interaction Network Ontology
Last uploaded:
June 27, 2014
Jump to:
| Preferred Name | fumaric acid | |
| Synonyms |
trans-1,2-ethylenedicarboxylic acid InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-N (2E)-2-butenedioic acid C4H4O4 InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ OC(=O)\C=C\C(O)=O trans-but-2-enedioic acid Fumarsaeure trans-Butenedioic acid E297 (E)-2-butenedioic acid FUMARIC ACID (2E)-but-2-enedioic acid Fumaric acid |
|
| Definitions |
A butenedioic acid in which the C=C double bond has E geometry. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18012 |
|
| database_cross_reference |
CiteXplore:21414846 PDBeChem:FUM MetaCyc:FUM CiteXplore:22113915 CiteXplore:22516248 Gmelin:49855 KEGG COMPOUND:C00122 CiteXplore:22217732 CiteXplore:17439666 ChemIDplus:110-17-8 KEGG DRUG:D02308 Wikipedia:Fumaric_Acid Beilstein:605763 HMDB:HMDB00134 Reaxys:605763 NIST Chemistry WebBook:110-17-8 KEGG COMPOUND:110-17-8
|
|
| definition |
A butenedioic acid in which the C=C double bond has E geometry.
|
|
| has_alternative_id |
CHEBI:24124 CHEBI:5190 CHEBI:42743
|
|
| has_exact_synonym |
FUMARIC ACID (2E)-but-2-enedioic acid Fumaric acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
trans-1,2-ethylenedicarboxylic acid InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-N (2E)-2-butenedioic acid C4H4O4 InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ OC(=O)\C=C\C(O)=O trans-but-2-enedioic acid Fumarsaeure trans-Butenedioic acid E297 (E)-2-butenedioic acid
|
|
| id |
CHEBI:18012
|
|
| imported from | ||
| label |
fumaric acid
|
|
| notation |
CHEBI:18012
|
|
| prefixIRI |
CHEBI:18012
|
|
| prefLabel |
fumaric acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping