loading...| Preferred Name |
lipoic acid |
|
| Synonyms |
5-(1,2-dithiolan-3-yl)pentanoic acid 6,8-thiotic acid 5-(dithiolan-3-yl)valeric acid C8H14O2S2 1,2-dithiolane-3-pentanoic acid 6-thiotic acid InChIKey=AGBQKNBQESQNJD-UHFFFAOYSA-N 6,8-thioctic acid Thioctansaeure 5-[3-(1,2-dithiolanyl)]pentanoic acid Thioktsaeure InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) 5-(1,2-dithiolan-3-yl)valeric acid Acetate-replacing factor Biletan 1,2-dithiolane-3-valeric acid Thioctsaeure alpha-Liponsaeure 6-thioctic acid alpha-lipoic acid liponic acid OC(=O)CCCCC1CCSS1 |
|
| Definitions |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16494 |
|
| database_cross_reference |
Reaxys:81853 Beilstein:122410 Beilstein:81853 CiteXplore:7519986 DrugBank:DB00166 NIST Chemistry WebBook:62-46-4 Gmelin:720915 CiteXplore:7548757 ChemIDplus:62-46-4 |
|
| definition |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
| has_alternative_id |
CHEBI:25058 CHEBI:6492 CHEBI:146958 |
|
| has_exact_synonym |
5-(1,2-dithiolan-3-yl)pentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
6,8-thiotic acid 5-(dithiolan-3-yl)valeric acid C8H14O2S2 1,2-dithiolane-3-pentanoic acid 6-thiotic acid InChIKey=AGBQKNBQESQNJD-UHFFFAOYSA-N 6,8-thioctic acid Thioctansaeure 5-[3-(1,2-dithiolanyl)]pentanoic acid Thioktsaeure InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) 5-(1,2-dithiolan-3-yl)valeric acid Acetate-replacing factor Biletan 1,2-dithiolane-3-valeric acid Thioctsaeure alpha-Liponsaeure 6-thioctic acid alpha-lipoic acid liponic acid OC(=O)CCCCC1CCSS1 |
|
| id |
CHEBI:16494 |
|
| imported from | ||
| label |
lipoic acid |
|
| notation |
CHEBI:16494 |
|
| prefixIRI |
CHEBI:16494 |
|
| prefLabel |
lipoic acid |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_39192 |