loading...| Preferred Name | tolnaftate | |
| Synonyms |
m,N-Dimethylthiocarbanilic acid O-2-naphthyl ester tolnaftatum O-2-Naphthyl m,N-dimethylthiocarbanilate 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate N-methyl-N-(3-methylphenyl)-1-(naphthalen-2-yloxy)methanethioamide Methyl (3-methylphenyl)carbamothioic acid O-2-naphthalenyl ester Tolnaphthate Separin Tinactin tolnaftate tolnaftato O-2-naphthyl methyl(3-methylphenyl)carbamothioate |
|
| Definitions |
A monothiocarbamic ester that is the methyl(3-tolyl)carbamothioate ester of 2-naphthol. A synthetic anti-fungal agent used to treat jock itch, athlete's foot and ringworm. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9620 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20347664 PMID:20635527 Patent:US2010035939 HMDB:HMDB0005005 PMID:24706116 KEGG:D00381 DrugBank:DB00525 PMID:2061794 Drug_Central:3617 Patent:WO2010037089 CAS:2398-96-1 LINCS:LSM-5554 PMID:5856396 PMID:3509341 PMID:4568708 PMID:5952516 Reaxys:2752620 PMID:5745067 PMID:22125963 PMID:5319027 PMID:5847820 PMID:5705341 PMID:697362 Wikipedia:Tolnaftate PMID:21565546 |
|
| definition |
A monothiocarbamic ester that is the methyl(3-tolyl)carbamothioate ester of 2-naphthol. A synthetic anti-fungal agent used to treat jock itch, athlete's foot and ringworm. |
|
| formula |
C19H17NOS |
|
| has characteristic | ||
| has functional parent | ||
| has role | ||
| has_exact_synonym |
O-2-naphthyl methyl(3-methylphenyl)carbamothioate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
m,N-Dimethylthiocarbanilic acid O-2-naphthyl ester tolnaftatum O-2-Naphthyl m,N-dimethylthiocarbanilate 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate N-methyl-N-(3-methylphenyl)-1-(naphthalen-2-yloxy)methanethioamide Methyl (3-methylphenyl)carbamothioic acid O-2-naphthalenyl ester Tolnaphthate Separin Tinactin tolnaftate tolnaftato |
|
| id |
CHEBI:9620 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3 |
|
| inchikey |
FUSNMLFNXJSCDI-UHFFFAOYSA-N |
|
| label |
tolnaftate |
|
| mass |
307.40900 |
|
| monoisotopicmass |
307.10309 |
|
| notation |
CHEBI:9620 |
|
| prefLabel |
tolnaftate |
|
| smiles |
CN(C(=S)Oc1ccc2ccccc2c1)c1cccc(C)c1 |
|
| subClassOf |