Jump to:
loading...| Preferred Name | 2-amino-3-methylpentanoic acid | |
| Synonyms |
2-amino-3-methylpentanoic acid |
|
| Definitions |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38264 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:443-79-8 PMID:10944265 KEGG:C16434 Reaxys:1721790 |
|
| definition |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
| formula |
C6H13NO2 |
|
| has_exact_synonym |
2-amino-3-methylpentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:38264 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
|
| inchikey |
AGPKZVBTJJNPAG-UHFFFAOYSA-N |
|
| label |
2-amino-3-methylpentanoic acid |
|
| mass |
131.17296 |
|
| monoisotopicmass |
131.09463 |
|
| notation |
CHEBI:38264 |
|
| prefLabel |
2-amino-3-methylpentanoic acid |
|
| smiles |
CCC(C)C(N)C(O)=O |
|
| subClassOf |
Create mapping