loading...| Preferred Name | oxaliplatin | |
| Synonyms |
oxaliplatin oxalato(1,2-diaminocyclohexane)platinum(II) oxaliplatinum oxaliplatine (SP-4-2-(1R-trans))-(1,2-cyclohexanediamine-N,N')(ethanedioato(2-)-O,O')platinum oxaliplatino Eloxatin Oxaliplatin (SP-4-2)[(1R,2R)-cyclohexane-1,2-diamine-kappa(2)N,N'][ethanedioato(2-)-kappa(2)O(1),O(2)]platinum |
|
| Definitions |
A platinum coordination entity that is a commonly used chemothrepeutic drug for treatment of colorectal cancer. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31941 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18440088 PMID:19735649 PMID:28894576 PMID:28624791 PMID:28876454 KEGG:D01790 LINCS:LSM-6352 Gmelin:28892 PMID:28762171 PMID:28938919 PMID:28505615 PMID:28800641 PMID:28186109 PMID:14755010 PMID:15477639 PMID:28812173 PMID:28881354 PMID:28642473 Reaxys:15700099 PMID:28811232 PMID:28884286 PMID:19138416 PMID:28398406 Gmelin:1046012 PMID:17347561 PMID:28777427 Wikipedia:Oxaliplatin PMID:28499428 PMID:28415810 PMID:11300320 CAS:63121-00-6 PMID:28837658 PMID:28695397 PMID:28654098 DrugBank:DB00526 PMID:28881481 CAS:61825-94-3 PMID:28924870 PMID:27756654 |
|
| definition |
A platinum coordination entity that is a commonly used chemothrepeutic drug for treatment of colorectal cancer. |
|
| formula |
C8H14N2O4Pt C6H14N2.C2O4.Pt |
|
| has characteristic | ||
| has role | ||
| has_exact_synonym |
Oxaliplatin (SP-4-2)[(1R,2R)-cyclohexane-1,2-diamine-kappa(2)N,N'][ethanedioato(2-)-kappa(2)O(1),O(2)]platinum |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
oxaliplatin oxalato(1,2-diaminocyclohexane)platinum(II) oxaliplatinum oxaliplatine (SP-4-2-(1R-trans))-(1,2-cyclohexanediamine-N,N')(ethanedioato(2-)-O,O')platinum oxaliplatino Eloxatin |
|
| id |
CHEBI:31941 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H14N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-6H,1-4,7-8H2;(H,3,4)(H,5,6);/q;;+2/p-2/t5-,6-;;/m1../s1 |
|
| inchikey |
ZROHGHOFXNOHSO-BNTLRKBRSA-L |
|
| label |
oxaliplatin |
|
| mass |
397.28584 |
|
| monoisotopicmass |
397.06015 |
|
| notation |
CHEBI:31941 |
|
| prefLabel |
oxaliplatin |
|
| smiles |
[H][N]1([H])[C@@H]2CCCC[C@H]2[N]([H])([H])[Pt]11OC(=O)C(=O)O1 |
|
| subClassOf |