Preferred Name |
theobromine |
|
Synonyms |
|
|
Definitions |
A dimethylxanthine having the two methyl groups located at positions 3 and 7. A purine alkaloid derived from the cacao plant, it is found in chocolate, as well as in a number of other foods, and is a vasodilator, diuretic and heart stimulator. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28946 |
|
BiomarkerOf |
http://purl.obolibrary.org/obo/FOODON_00001139 |
|
ChemSpider |
11181178 |
|
FOBI |
FOBI:030657 |
|
HMDB |
HMDB02825 |
|
id |
CHEBI:28946 |
|
imported from | ||
InChICode |
InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
|
InChIKey |
YAPQBXQYLJRXSA-UHFFFAOYSA-N |
|
KEGG |
C07480 |
|
label |
theobromine |
|
notation |
CHEBI:28946 |
|
prefixIRI |
CHEBI:28946 |
|
prefLabel |
theobromine |
|
PubChemCID |
5429 |
|
textual definition |
A dimethylxanthine having the two methyl groups located at positions 3 and 7. A purine alkaloid derived from the cacao plant, it is found in chocolate, as well as in a number of other foods, and is a vasodilator, diuretic and heart stimulator. |
|
subClassOf |