Jump to:
loading...| Preferred Name | 2-aminophenol | |
| Synonyms |
|
|
| Definitions |
The aminophenol which has the single amino substituent located ortho to the phenolic -OH group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18112 |
|
| BiomarkerOf | ||
| ChemSpider |
11613535 | 14598679 |
|
| FOBI |
FOBI:030671 |
|
| id |
CHEBI:18112 |
|
| imported from | ||
| InChICode |
InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 |
|
| InChIKey |
CDAWCLOXVUBKRW-UHFFFAOYSA-N |
|
| KEGG |
C01987 |
|
| label |
2-aminophenol |
|
| notation |
CHEBI:18112 |
|
| prefixIRI |
CHEBI:18112 |
|
| prefLabel |
2-aminophenol |
|
| PubChemCID |
5801 |
|
| textual definition |
The aminophenol which has the single amino substituent located ortho to the phenolic -OH group. |
|
| subClassOf |
Create mapping