Preferred Name |
terbinafine |
|
Synonyms |
terbinafinum (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalene methanamine terbinafine (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine terbinafina (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine |
|
Definitions |
A tertiary amine that is N-methyl-1-naphthalenemethylamine in which the amino hydrogen is replaced by a 3-(tertbutylethynyl)allyl group. An antifungal agent administered orally (generally as the hydrochloride salt) for the treatment of skin and nail infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9448 |
|
charge |
0 |
|
database_cross_reference |
PMID:24563892 PMID:24389279 PMID:24490976 PMID:24410098 HMDB:HMDB0014995 PMID:24126579 CAS:91161-71-6 PMID:24533442 PMID:24447130 KEGG:D02375 PMID:23802806 PMID:23750489 PMID:24581620 PMID:23841559 Wikipedia:Terbinafine PMID:23895037 Reaxys:4256376 PMID:24497012 KEGG:C08079 PMID:24452843 PMID:24477462 PMID:24576265 PMID:24352873 PMID:24588014 MetaCyc:CPD-10571 Drug_Central:2597 DrugBank:DB00857 |
|
definition |
A tertiary amine that is N-methyl-1-naphthalenemethylamine in which the amino hydrogen is replaced by a 3-(tertbutylethynyl)allyl group. An antifungal agent administered orally (generally as the hydrochloride salt) for the treatment of skin and nail infections. |
|
formula |
C21H25N |
|
has_exact_synonym |
(2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine terbinafine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
terbinafinum (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalene methanamine terbinafine (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine terbinafina |
|
id |
CHEBI:9448 |
|
in_subset | ||
inchi |
InChI=1S/C21H25N/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19/h5-7,9-14H,16-17H2,1-4H3/b9-5+ |
|
inchikey |
DOMXUEMWDBAQBQ-WEVVVXLNSA-N |
|
label |
terbinafine |
|
mass |
291.42990 |
|
monoisotopicmass |
291.19870 |
|
notation |
CHEBI:9448 |
|
preferred label |
terbinafine |
|
prefLabel |
terbinafine |
|
smiles |
CN(C\C=C\C#CC(C)(C)C)Cc1cccc2ccccc12 |
|
subClassOf |