Preferred Name |
taurochenodeoxycholate |
|
Synonyms |
Taurochenodeoxycholate 2-[(3alpha,7alpha-dihydroxy-24-oxo-5beta-cholan-24-yl)amino]ethanesulfonate taurochenodeoxycholate taurochenodeoxycholate anion taurochenodeoxycholate(1-) |
|
Definitions |
An organosulfonate oxoanion that is the conjugate base of taurochenodeoxycholic acid arising from deprotonation of the sulfonate OH group; major species at pH 7.3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9407 |
|
charge |
-1 |
|
database_cross_reference |
Beilstein:3919127 KEGG:C05465 |
|
definition |
An organosulfonate oxoanion that is the conjugate base of taurochenodeoxycholic acid arising from deprotonation of the sulfonate OH group; major species at pH 7.3. |
|
formula |
C26H44NO6S |
|
has_alternative_id |
CHEBI:57802 |
|
has_exact_synonym |
Taurochenodeoxycholate 2-[(3alpha,7alpha-dihydroxy-24-oxo-5beta-cholan-24-yl)amino]ethanesulfonate taurochenodeoxycholate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
taurochenodeoxycholate anion taurochenodeoxycholate(1-) |
|
id |
CHEBI:9407 |
|
in_subset | ||
inchi |
InChI=1S/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/p-1/t16-,17+,18-,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
|
inchikey |
BHTRKEVKTKCXOH-BJLOMENOSA-M |
|
label |
taurochenodeoxycholate |
|
mass |
498.69670 |
|
monoisotopicmass |
498.28948 |
|
notation |
CHEBI:9407 |
|
prefLabel |
taurochenodeoxycholate |
|
smiles |
[H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@H](O)C2)[C@H](C)CCC(=O)NCCS([O-])(=O)=O |
|
subClassOf |