Preferred Name |
hexadecanoate |
|
Synonyms |
hexadecanoate n-hexadecanoate CH3-[CH2]14-COO(-) 1-pentadecanecarboxylate pentadecanecarboxylate 1-hexyldecanoate Hexadecanoic acid, ion(1-) n-hexadecoate palmitate (16:0) |
|
Definitions |
A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7896 |
|
charge |
-1 |
|
database_cross_reference |
CAS:143-20-4 Reaxys:3589907 Beilstein:3589907 Gmelin:344266 MetaCyc:PALMITATE HMDB:HMDB0000220 |
|
definition |
A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3. |
|
formula |
C16H31O2 |
|
has_alternative_id |
CHEBI:231736 |
|
has_exact_synonym |
hexadecanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
n-hexadecanoate CH3-[CH2]14-COO(-) 1-pentadecanecarboxylate pentadecanecarboxylate 1-hexyldecanoate Hexadecanoic acid, ion(1-) n-hexadecoate palmitate (16:0) |
|
id |
CHEBI:7896 |
|
in_subset | ||
inchi |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1 |
|
inchikey |
IPCSVZSSVZVIGE-UHFFFAOYSA-M |
|
label |
hexadecanoate |
|
mass |
255.41610 |
|
monoisotopicmass |
255.23295 |
|
notation |
CHEBI:7896 |
|
prefLabel |
hexadecanoate |
|
smiles |
CCCCCCCCCCCCCCCC([O-])=O |
|
subClassOf |