loading...| Preferred Name |
iloprost |
|
| Synonyms |
(5E)-5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl]hexahydropentalen-2(1H)-ylidene]pentanoic acid iloprostum iloprost (16R,S)-methyl-18,18,19,19-tetradehydro-6a-carbaprostaglandin I2 |
|
| Definitions |
A carbobicyclic compound that is prostaglandin I2 in which the endocyclic oxygen is replaced by a methylene group and in which the (1E,3S)-3-hydroxyoct-1-en-1-yl side chain is replaced by a (3R)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl group. A synthetic analogue of prostacyclin, it is used as the trometamol salt (generally by intravenous infusion) for the treatment of peripheral vascular disease and pulmonary hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63916 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG DRUG:78919-13-8 NCIt:C48397 CiteXplore:14719835 ChEMBL:107494 MeSH:D016285 CiteXplore:19436672 SNOMEDCT:319452005 CiteXplore:15241524 Reaxys:4329060 KEGG DRUG:D02721 CiteXplore:15232651 SNOMEDCT:395740002 PMID:14719835 Patent:US4692464 KEGG:D02721 DrugBank:DB01088 PMID:19436672 PMID:15232651 Patent:DE2845770 CAS:78919-13-8 Wikipedia:Iloprost PMID:15241524 Drug_Central:1422 |
|
| definition |
A carbobicyclic compound that is prostaglandin I2 in which the endocyclic oxygen is replaced by a methylene group and in which the (1E,3S)-3-hydroxyoct-1-en-1-yl side chain is replaced by a (3R)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl group. A synthetic analogue of prostacyclin, it is used as the trometamol salt (generally by intravenous infusion) for the treatment of peripheral vascular disease and pulmonary hypertension. |
|
| formula |
C22H32O4 |
|
| has_exact_synonym |
(5E)-5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl]hexahydropentalen-2(1H)-ylidene]pentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
iloprostum iloprost (16R,S)-methyl-18,18,19,19-tetradehydro-6a-carbaprostaglandin I2 |
|
| has_role | ||
| id |
CHEBI:63916 |
|
| in_subset | ||
| inchi |
InChI=1S/C22H32O4/c1-3-4-7-15(2)20(23)11-10-18-19-13-16(8-5-6-9-22(25)26)12-17(19)14-21(18)24/h8,10-11,15,17-21,23-24H,5-7,9,12-14H2,1-2H3,(H,25,26)/b11-10+,16-8+/t15?,17-,18+,19-,20+,21+/m0/s1 |
|
| inchikey |
HIFJCPQKFCZDDL-ACWOEMLNSA-N |
|
| label |
iloprost |
|
| mass |
360.48710 |
|
| monoisotopicmass |
360.23006 |
|
| notation |
CHEBI:63916 |
|
| prefLabel |
iloprost |
|
| smiles |
[H][C@]1(\C=C\[C@@H](O)C(C)CC#CC)[C@H](O)C[C@@H]2C\C(C[C@H]12)=C/CCCC(O)=O |
|
| subClassOf |