Preferred Name |
propofol |
|
Synonyms |
Disoprivan 2,6-bis(1-methylethyl)phenol 2,6-Diisopropylphenol propofol Disoprofol propofolum Diprivan 2,6-BIS(1-METHYLETHYL)PHENOL Rapinovet 2,6-bis(propan-2-yl)phenol Propofol |
|
Definitions |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_44915 |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:387423006 MeSH:D015742 SNOMEDCT:74674007 NCIt:C29384 PDBeChem:PFL KEGG:C07523 DrugBank:DB00818 Beilstein:1866484 KEGG:D00549 VSDB:1846 CAS:2078-54-8 Drug_Central:2302 Wikipedia:Propofol LINCS:LSM-3847 |
|
definition |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
formula |
C12H18O |
|
has_alternative_id |
CHEBI:8495 CHEBI:44914 |
|
has_exact_synonym |
2,6-bis(propan-2-yl)phenol Propofol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Disoprivan 2,6-bis(1-methylethyl)phenol 2,6-Diisopropylphenol propofol Disoprofol propofolum Diprivan 2,6-BIS(1-METHYLETHYL)PHENOL Rapinovet |
|
has_role |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
id |
CHEBI:44915 |
|
in_subset | ||
inchi |
InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 |
|
inchikey |
OLBCVFGFOZPWHH-UHFFFAOYSA-N |
|
label |
propofol |
|
mass |
178.27072 |
|
monoisotopicmass |
178.13577 |
|
notation |
CHEBI:44915 |
|
preferred label |
propofol |
|
prefLabel |
propofol |
|
smiles |
CC(C)c1cccc(C(C)C)c1O |
|
subClassOf |