Link to this page
Experimental Factor Ontology
Last uploaded:
December 16, 2024
Jump to:
| Preferred Name | 4-phenylbutyric acid | |
| Synonyms |
gamma-Phenyl-n-butyric acid omega-Phenylbutanoic acid gamma-phenylbutyric acid Benzenebutyric acid 4-Phenyl-n-butyric acid omega-phenylbutyric acid 4-PHENYL-BUTANOIC ACID PBA 4-phenylbutanoic acid |
|
| Definitions |
A monocarboxylic acid the structure of which is that of butyric acid substituted with a phenyl group at C-4. It is a histone deacetylase inhibitor that displays anticancer activity. It inhibits cell proliferation, invasion and migration and induces apoptosis in glioma cells. It also inhibits protein isoprenylation, depletes plasma glutamine, increases production of foetal haemoglobin through transcriptional activation of the gamma-globin gene and affects hPPARgamma activation. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_41500 |
|
| charge |
0
|
|
| database_cross_reference |
LINCS:LSM-5751 PMID:21894430 PDBeChem:CLT CiteXplore:21237159 PMID:21726539 CiteXplore:21894430 Drug_Central:24 PMID:20399799 CiteXplore:22359472 PMID:21887297 NCIt:C63699 MeSH:C075773 Reaxys:638180 PMID:21237159 ChEMBL:497873 CiteXplore:19918981 CiteXplore:20399799 ChemIDplus:1821-12-1 CiteXplore:22101259 MetaCyc:CPD-14367 PMID:19918981 PMID:22101259 CiteXplore:21726539 PMID:22359472 CiteXplore:21887297 HMDB:HMDB0000543 NIST Chemistry WebBook:1821-12-1 CAS:1821-12-1
|
|
| definition |
A monocarboxylic acid the structure of which is that of butyric acid substituted with a phenyl group at C-4. It is a histone deacetylase inhibitor that displays anticancer activity. It inhibits cell proliferation, invasion and migration and induces apoptosis in glioma cells. It also inhibits protein isoprenylation, depletes plasma glutamine, increases production of foetal haemoglobin through transcriptional activation of the gamma-globin gene and affects hPPARgamma activation.
|
|
| formula |
C10H12O2
|
|
| has_alternative_id |
CHEBI:64058
|
|
| has_exact_synonym |
4-phenylbutanoic acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
gamma-Phenyl-n-butyric acid omega-Phenylbutanoic acid gamma-phenylbutyric acid Benzenebutyric acid 4-Phenyl-n-butyric acid omega-phenylbutyric acid 4-PHENYL-BUTANOIC ACID PBA
|
|
| id |
CHEBI:41500
|
|
| in_subset | ||
| inchi |
InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12)
|
|
| inchikey |
OBKXEAXTFZPCHS-UHFFFAOYSA-N
|
|
| label |
4-phenylbutyric acid
|
|
| mass |
164.20110
|
|
| monoisotopicmass |
164.08373
|
|
| notation |
CHEBI:41500
|
|
| preferred label |
4-phenylbutyric acid
|
|
| prefLabel |
4-phenylbutyric acid
|
|
| smiles |
OC(=O)CCCc1ccccc1
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping