loading...| Preferred Name |
clofibric acid |
|
| Synonyms |
Clofibric acid 2-(4-chlorophenoxy)-2-methylpropanoic acid 2-(p-Chlorophenoxy)-2-methylpropionic acid 2-(p-Chlorophenoxy)isobutyric acid Clofibrinsaeure Chlorfibrinic acid acide clofibrique Chlorofibrinic acid Chlorophibrinic acid Acide (p-chlorophenoxy)-2 methyl-2 propionique 4-CPIB PCIB acidum clofibricum clofibric acid Clofibrate free acid PCPIB alpha-(p-chlorophenoxy)isobutyric acid acido clofibrico CPIB 2-(4-Chlorophenoxy)-2-methylpropionic acid alpha-(4-chlorophenoxy)-alpha-methylpropionic acid |
|
| Definitions |
A monocarboxylic acid that is isobutyric acid substituted at position 2 by a p-chlorophenoxy group. It is a metabolite of the drug clofibrate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34648 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1874067 NIST Chemistry WebBook:882-09-7 KEGG COMPOUND:C13700 ChemIDplus:882-09-7 KEGG COMPOUND:882-09-7 MeSH:D002995 NCIt:C81531 ChEMBL:129390 Wikipedia:Clofibric_Acid PMID:23352585 KEGG:D07723 Drug_Central:695 PMID:16442995 CAS:882-09-7 PMID:23135717 LINCS:LSM-2427 Wikipedia:Clofibric_acid PMID:8944746 Pesticides:clofibric%20acid KEGG:C13700 PMID:23062606 PMID:7320112 PMID:17431116 Reaxys:1874067 PPDB:2940 |
|
| definition |
A monocarboxylic acid that is isobutyric acid substituted at position 2 by a p-chlorophenoxy group. It is a metabolite of the drug clofibrate. |
|
| formula |
C10H11ClO3 |
|
| has_alternative_id |
CHEBI:73161 |
|
| has_exact_synonym |
Clofibric acid 2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(p-Chlorophenoxy)-2-methylpropionic acid 2-(p-Chlorophenoxy)isobutyric acid Clofibrinsaeure Chlorfibrinic acid acide clofibrique Chlorofibrinic acid Chlorophibrinic acid Acide (p-chlorophenoxy)-2 methyl-2 propionique 4-CPIB PCIB acidum clofibricum clofibric acid Clofibrate free acid PCPIB alpha-(p-chlorophenoxy)isobutyric acid acido clofibrico CPIB 2-(4-Chlorophenoxy)-2-methylpropionic acid alpha-(4-chlorophenoxy)-alpha-methylpropionic acid |
|
| id |
CHEBI:34648 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) |
|
| inchikey |
TXCGAZHTZHNUAI-UHFFFAOYSA-N |
|
| label |
clofibric acid |
|
| mass |
214.64524 |
|
| monoisotopicmass |
214.03967 |
|
| notation |
CHEBI:34648 |
|
| prefLabel |
clofibric acid |
|
| smiles |
CC(C)(Oc1ccc(Cl)cc1)C(O)=O |
|
| subClassOf |